About 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol
3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol (PubChem CID 104860639) has the molecular formula C8H17F2NO3S
and a molecular weight of 245.29 g/mol. Its IUPAC name is 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol |
| PubChem CID | 104860639 |
| Molecular Formula | C8H17F2NO3S |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol |
| SMILES | CCS(=O)(=O)CC(C)NCC(F)(F)CO |
| InChI | InChI=1S/C8H17F2NO3S/c1-3-15(13,14)4-7(2)11-5-8(9,10)6-12/h7,11-12H,3-6H2,1-2H3 |
| InChIKey | GMJKNLXFRCNZOR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol?
The IUPAC name of 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol (CID 104860639) is 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol is CCS(=O)(=O)CC(C)NCC(F)(F)CO.
What is the InChIKey of 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol?
The InChIKey is GMJKNLXFRCNZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2NO3S/c1-3-15(13,14)4-7(2)11-5-8(9,10)6-12/h7,11-12H,3-6H2,1-2H3.
What are the key properties of 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol?
3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol has a molecular weight of 245.29 g/mol, XLogP of 0.03, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethylsulfonylpropan-2-ylamino)-2,2-difluoropropan-1-ol is sourced from PubChem (CID 104860639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).