methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate

C7H13N3S2 — CID 104861451

IUPACmethyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate
SMILESCS/C(=N\CC(C)SC)NC#N
InChIInChI=1S/C7H13N3S2/c1-6(11-2)4-9-7(12-3)10-5-8/h6H,4H2,1-3H3,(H,9,10)
InChIKeyFVEUXVUKTZMJRN-UHFFFAOYSA-N
MW203.34 g/mol
LogP1.53
Rot. Bonds3

About methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate

methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate (PubChem CID 104861451) has the molecular formula C7H13N3S2 and a molecular weight of 203.34 g/mol. Its IUPAC name is methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate.

Molecular Properties

Compound Namemethyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate
PubChem CID104861451
Molecular FormulaC7H13N3S2
Molecular Weight203.34 g/mol
Exact Mass203.06
IUPAC Namemethyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate
SMILESCS/C(=N\CC(C)SC)NC#N
InChIInChI=1S/C7H13N3S2/c1-6(11-2)4-9-7(12-3)10-5-8/h6H,4H2,1-3H3,(H,9,10)
InChIKeyFVEUXVUKTZMJRN-UHFFFAOYSA-N
XLogP1.53
TPSA48.18 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.34
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate?
The IUPAC name of methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate (CID 104861451) is methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate.
What is the SMILES notation for methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate?
The canonical SMILES for methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate is CS/C(=N\CC(C)SC)NC#N.
What is the InChIKey of methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate?
The InChIKey is FVEUXVUKTZMJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S2/c1-6(11-2)4-9-7(12-3)10-5-8/h6H,4H2,1-3H3,(H,9,10).
What are the key properties of methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate?
methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate has a molecular weight of 203.34 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-cyano-N'-(2-methylsulfanylpropyl)carbamimidothioate is sourced from PubChem (CID 104861451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).