About (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide
(E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide (PubChem CID 104862783) has the molecular formula C10H13F2N3O2
and a molecular weight of 245.23 g/mol. Its IUPAC name is (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide |
| PubChem CID | 104862783 |
| Molecular Formula | C10H13F2N3O2 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide |
| SMILES | Cn1nccc1/C=C/C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C10H13F2N3O2/c1-15-8(4-5-14-15)2-3-9(17)13-6-10(11,12)7-16/h2-5,16H,6-7H2,1H3,(H,13,17)/b3-2+ |
| InChIKey | NOZQWWITIHJCQT-NSCUHMNNSA-N |
| XLogP | 0.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide?
The IUPAC name of (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide (CID 104862783) is (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide?
The canonical SMILES for (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide is Cn1nccc1/C=C/C(=O)NCC(F)(F)CO.
What is the InChIKey of (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide?
The InChIKey is NOZQWWITIHJCQT-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H13F2N3O2/c1-15-8(4-5-14-15)2-3-9(17)13-6-10(11,12)7-16/h2-5,16H,6-7H2,1H3,(H,13,17)/b3-2+.
What are the key properties of (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide?
(E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide has a molecular weight of 245.23 g/mol, XLogP of 0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide is sourced from PubChem (CID 104862783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).