C9H12N2O3S — CID 104862990
(3S)-3-acetamido-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid (PubChem CID 104862990) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is (3S)-3-acetamido-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid.
| Compound Name | (3S)-3-acetamido-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 104862990 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (3S)-3-acetamido-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)c1csc(C)n1 |
| InChI | InChI=1S/C9H12N2O3S/c1-5(12)10-7(3-9(13)14)8-4-15-6(2)11-8/h4,7H,3H2,1-2H3,(H,10,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | QXICHKWMPWAMII-ZETCQYMHSA-N |
| XLogP | 1.10 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |