C12H23NO — CID 104863204
N-(6-methoxy-4,5-dimethylhex-3-enyl)cyclopropanamine (PubChem CID 104863204) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-(6-methoxy-4,5-dimethylhex-3-enyl)cyclopropanamine.
| Compound Name | N-(6-methoxy-4,5-dimethylhex-3-enyl)cyclopropanamine |
|---|---|
| PubChem CID | 104863204 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-(6-methoxy-4,5-dimethylhex-3-enyl)cyclopropanamine |
| SMILES | COCC(C)C(C)=CCCNC1CC1 |
| InChI | InChI=1S/C12H23NO/c1-10(11(2)9-14-3)5-4-8-13-12-6-7-12/h5,11-13H,4,6-9H2,1-3H3 |
| InChIKey | BKAUVLNHLPSAKF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|