C12H23NO — CID 104863212
2-(4-methoxy-2,3-dimethylbut-2-enyl)piperidine (PubChem CID 104863212) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-(4-methoxy-2,3-dimethylbut-2-enyl)piperidine.
| Compound Name | 2-(4-methoxy-2,3-dimethylbut-2-enyl)piperidine |
|---|---|
| PubChem CID | 104863212 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-(4-methoxy-2,3-dimethylbut-2-enyl)piperidine |
| SMILES | COCC(C)=C(C)CC1CCCCN1 |
| InChI | InChI=1S/C12H23NO/c1-10(11(2)9-14-3)8-12-6-4-5-7-13-12/h12-13H,4-9H2,1-3H3 |
| InChIKey | SBVNRIQQWNEFMQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|