About 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine
3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine (PubChem CID 104863213) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine.
Molecular Properties
| Compound Name | 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine |
| PubChem CID | 104863213 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine |
| SMILES | COCC(C)=C(C)CC1COCCN1 |
| InChI | InChI=1S/C11H21NO2/c1-9(10(2)7-13-3)6-11-8-14-5-4-12-11/h11-12H,4-8H2,1-3H3 |
| InChIKey | BJDPWOUXPBVERL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine?
The IUPAC name of 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine (CID 104863213) is 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine.
What is the SMILES notation for 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine?
The canonical SMILES for 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine is COCC(C)=C(C)CC1COCCN1.
What is the InChIKey of 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine?
The InChIKey is BJDPWOUXPBVERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-9(10(2)7-13-3)6-11-8-14-5-4-12-11/h11-12H,4-8H2,1-3H3.
What are the key properties of 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine?
3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine has a molecular weight of 199.29 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-2,3-dimethylbut-2-enyl)morpholine is sourced from PubChem (CID 104863213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).