C88H106 — CID 10486457
1-[bis[5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylphenyl]methyl]-5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylbenzene (PubChem CID 10486457) has the molecular formula C88H106 and a molecular weight of 1163.82 g/mol. Its IUPAC name is 1-[bis[5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylphenyl]methyl]-5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylbenzene.
| Compound Name | 1-[bis[5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylphenyl]methyl]-5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 10486457 |
| Molecular Formula | C88H106 |
| Molecular Weight | 1163.82 g/mol |
| Exact Mass | 1162.83 |
| IUPAC Name | 1-[bis[5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylphenyl]methyl]-5-[bis(4-tert-butylphenyl)methyl]-2,4-dimethylbenzene |
| SMILES | Cc1cc(C)c(C(c2cc(C(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c(C)cc2C)c2cc(C(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c(C)cc2C)cc1C(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C88H106/c1-55-49-58(4)76(52-73(55)79(61-25-37-67(38-26-61)83(7,8)9)62-27-39-68(40-28-62)84(10,11)12)82(77-53-74(56(2)50-59(77)5)80(63-29-41-69(42-30-63)85(13,14)15)64-31-43-70(44-32-64)86(16,17)18)78-54-75(57(3)51-60(78)6)81(65-33-45-71(46-34-65)87(19,20)21)66-35-47-72(48-36-66)88(22,23)24/h25-54,79-82H,1-24H3 |
| InChIKey | PFDSUCZXYVHDBM-UHFFFAOYSA-N |
| XLogP | 24.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.82 |
| LogP ≤ 5 | 24.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|