About (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide
(2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide (PubChem CID 104864652) has the molecular formula C11H22N2O2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide |
| PubChem CID | 104864652 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)NC1CCS(=O)CC1 |
| InChI | InChI=1S/C11H22N2O2S/c1-11(2,3)9(12)10(14)13-8-4-6-16(15)7-5-8/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8?,9-,16?/m0/s1 |
| InChIKey | IWMJMJBNPRJIKG-OYNLBEDRSA-N |
| XLogP | 0.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide?
The IUPAC name of (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide (CID 104864652) is (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide.
What is the SMILES notation for (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide?
The canonical SMILES for (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide is CC(C)(C)[C@@H](N)C(=O)NC1CCS(=O)CC1.
What is the InChIKey of (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide?
The InChIKey is IWMJMJBNPRJIKG-OYNLBEDRSA-N. The full InChI is InChI=1S/C11H22N2O2S/c1-11(2,3)9(12)10(14)13-8-4-6-16(15)7-5-8/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8?,9-,16?/m0/s1.
What are the key properties of (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide?
(2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide has a molecular weight of 246.38 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3,3-dimethyl-N-(1-oxothian-4-yl)butanamide is sourced from PubChem (CID 104864652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).