C7H13Cl2NOS — CID 104866015
2,3-dichloro-N-(3-methylsulfinylpropyl)prop-2-en-1-amine (PubChem CID 104866015) has the molecular formula C7H13Cl2NOS and a molecular weight of 230.16 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-methylsulfinylpropyl)prop-2-en-1-amine.
| Compound Name | 2,3-dichloro-N-(3-methylsulfinylpropyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 104866015 |
| Molecular Formula | C7H13Cl2NOS |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2,3-dichloro-N-(3-methylsulfinylpropyl)prop-2-en-1-amine |
| SMILES | CS(=O)CCCNCC(Cl)=CCl |
| InChI | InChI=1S/C7H13Cl2NOS/c1-12(11)4-2-3-10-6-7(9)5-8/h5,10H,2-4,6H2,1H3 |
| InChIKey | XMSXEJSGZJDGKR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|