C17H34N2O2S — CID 104867074
tert-butyl N-[[2-(1-methylsulfanylbutan-2-ylamino)cyclohexyl]methyl]carbamate (PubChem CID 104867074) has the molecular formula C17H34N2O2S and a molecular weight of 330.54 g/mol. Its IUPAC name is tert-butyl N-[[2-(1-methylsulfanylbutan-2-ylamino)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(1-methylsulfanylbutan-2-ylamino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 104867074 |
| Molecular Formula | C17H34N2O2S |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl N-[[2-(1-methylsulfanylbutan-2-ylamino)cyclohexyl]methyl]carbamate |
| SMILES | CCC(CSC)NC1CCCCC1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N2O2S/c1-6-14(12-22-5)19-15-10-8-7-9-13(15)11-18-16(20)21-17(2,3)4/h13-15,19H,6-12H2,1-5H3,(H,18,20) |
| InChIKey | DWVFWDRUMBSWKI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |