C11H18N2S — CID 104867871
(2S)-2-N-(2-phenylsulfanylethyl)propane-1,2-diamine (PubChem CID 104867871) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is (2S)-2-N-(2-phenylsulfanylethyl)propane-1,2-diamine.
| Compound Name | (2S)-2-N-(2-phenylsulfanylethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 104867871 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (2S)-2-N-(2-phenylsulfanylethyl)propane-1,2-diamine |
| SMILES | C[C@@H](CN)NCCSc1ccccc1 |
| InChI | InChI=1S/C11H18N2S/c1-10(9-12)13-7-8-14-11-5-3-2-4-6-11/h2-6,10,13H,7-9,12H2,1H3/t10-/m0/s1 |
| InChIKey | IVHPHESVKMLMMX-JTQLQIEISA-N |
| XLogP | 1.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|