C9H20N2S — CID 104867949
(2R)-2-N-(thian-2-ylmethyl)propane-1,2-diamine (PubChem CID 104867949) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is (2R)-2-N-(thian-2-ylmethyl)propane-1,2-diamine.
| Compound Name | (2R)-2-N-(thian-2-ylmethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 104867949 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2R)-2-N-(thian-2-ylmethyl)propane-1,2-diamine |
| SMILES | C[C@H](CN)NCC1CCCCS1 |
| InChI | InChI=1S/C9H20N2S/c1-8(6-10)11-7-9-4-2-3-5-12-9/h8-9,11H,2-7,10H2,1H3/t8-,9?/m1/s1 |
| InChIKey | ADJFKABXZRMQFR-VEDVMXKPSA-N |
| XLogP | 1.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |