About 1,1,2-trifluoropropane
1,1,2-trifluoropropane (PubChem CID 10486802) has the molecular formula C3H5F3
and a molecular weight of 98.07 g/mol. Its IUPAC name is 1,1,2-trifluoropropane.
Molecular Properties
| Compound Name | 1,1,2-trifluoropropane |
| PubChem CID | 10486802 |
| Molecular Formula | C3H5F3 |
| Molecular Weight | 98.07 g/mol |
| Exact Mass | 98.03 |
| IUPAC Name | 1,1,2-trifluoropropane |
| SMILES | CC(F)C(F)F |
| InChI | InChI=1S/C3H5F3/c1-2(4)3(5)6/h2-3H,1H3 |
| InChIKey | HHRQYHKSSIGXJV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.07 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1,2-trifluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trifluoropropane?
The IUPAC name of 1,1,2-trifluoropropane (CID 10486802) is 1,1,2-trifluoropropane.
What is the SMILES notation for 1,1,2-trifluoropropane?
The canonical SMILES for 1,1,2-trifluoropropane is CC(F)C(F)F.
What is the InChIKey of 1,1,2-trifluoropropane?
The InChIKey is HHRQYHKSSIGXJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5F3/c1-2(4)3(5)6/h2-3H,1H3.
What are the key properties of 1,1,2-trifluoropropane?
1,1,2-trifluoropropane has a molecular weight of 98.07 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoropropane is sourced from PubChem (CID 10486802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).