C13H21N3 — CID 104869689
5-[(1S)-1-aminoethyl]-N-methyl-N-pent-4-enylpyridin-2-amine (PubChem CID 104869689) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-[(1S)-1-aminoethyl]-N-methyl-N-pent-4-enylpyridin-2-amine.
| Compound Name | 5-[(1S)-1-aminoethyl]-N-methyl-N-pent-4-enylpyridin-2-amine |
|---|---|
| PubChem CID | 104869689 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-[(1S)-1-aminoethyl]-N-methyl-N-pent-4-enylpyridin-2-amine |
| SMILES | C=CCCCN(C)c1ccc([C@H](C)N)cn1 |
| InChI | InChI=1S/C13H21N3/c1-4-5-6-9-16(3)13-8-7-12(10-15-13)11(2)14/h4,7-8,10-11H,1,5-6,9,14H2,2-3H3/t11-/m0/s1 |
| InChIKey | CLEFGYCTEVXJKO-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|