C14H20N2O3 — CID 104869735
(1S)-1-[4-[methyl(pent-4-enyl)amino]-3-nitrophenyl]ethanol (PubChem CID 104869735) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is (1S)-1-[4-[methyl(pent-4-enyl)amino]-3-nitrophenyl]ethanol.
| Compound Name | (1S)-1-[4-[methyl(pent-4-enyl)amino]-3-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 104869735 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1S)-1-[4-[methyl(pent-4-enyl)amino]-3-nitrophenyl]ethanol |
| SMILES | C=CCCCN(C)c1ccc([C@H](C)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O3/c1-4-5-6-9-15(3)13-8-7-12(11(2)17)10-14(13)16(18)19/h4,7-8,10-11,17H,1,5-6,9H2,2-3H3/t11-/m0/s1 |
| InChIKey | IISANRLNPWRFQD-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|