About 2-ethoxy-7-methyl-1H-1,3-diazepine
2-ethoxy-7-methyl-1H-1,3-diazepine (PubChem CID 10487045) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-ethoxy-7-methyl-1H-1,3-diazepine.
Molecular Properties
| Compound Name | 2-ethoxy-7-methyl-1H-1,3-diazepine |
| PubChem CID | 10487045 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-ethoxy-7-methyl-1H-1,3-diazepine |
| SMILES | CCOC1=NC=CC=C(C)N1 |
| InChI | InChI=1S/C8H12N2O/c1-3-11-8-9-6-4-5-7(2)10-8/h4-6H,3H2,1-2H3,(H,9,10) |
| InChIKey | FFGUIADTLVOHHR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-7-methyl-1H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-7-methyl-1H-1,3-diazepine?
The IUPAC name of 2-ethoxy-7-methyl-1H-1,3-diazepine (CID 10487045) is 2-ethoxy-7-methyl-1H-1,3-diazepine.
What is the SMILES notation for 2-ethoxy-7-methyl-1H-1,3-diazepine?
The canonical SMILES for 2-ethoxy-7-methyl-1H-1,3-diazepine is CCOC1=NC=CC=C(C)N1.
What is the InChIKey of 2-ethoxy-7-methyl-1H-1,3-diazepine?
The InChIKey is FFGUIADTLVOHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-3-11-8-9-6-4-5-7(2)10-8/h4-6H,3H2,1-2H3,(H,9,10).
What are the key properties of 2-ethoxy-7-methyl-1H-1,3-diazepine?
2-ethoxy-7-methyl-1H-1,3-diazepine has a molecular weight of 152.20 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-7-methyl-1H-1,3-diazepine is sourced from PubChem (CID 10487045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).