C10H17F2N3O2 — CID 104871088
N-(2,2-difluoroethyl)-1-(N'-hydroxycarbamimidoyl)-N-methylcyclopentane-1-carboxamide (PubChem CID 104871088) has the molecular formula C10H17F2N3O2 and a molecular weight of 249.26 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-(N'-hydroxycarbamimidoyl)-N-methylcyclopentane-1-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-1-(N'-hydroxycarbamimidoyl)-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 104871088 |
| Molecular Formula | C10H17F2N3O2 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-(N'-hydroxycarbamimidoyl)-N-methylcyclopentane-1-carboxamide |
| SMILES | CN(CC(F)F)C(=O)C1(C(N)=NO)CCCC1 |
| InChI | InChI=1S/C10H17F2N3O2/c1-15(6-7(11)12)9(16)10(8(13)14-17)4-2-3-5-10/h7,17H,2-6H2,1H3,(H2,13,14) |
| InChIKey | ZYDSVSRBPSDKKB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|