C11H18N2O5 — CID 104871392
(2R)-2-(1-cyclobutylethylcarbamoylamino)butanedioic acid (PubChem CID 104871392) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2R)-2-(1-cyclobutylethylcarbamoylamino)butanedioic acid.
| Compound Name | (2R)-2-(1-cyclobutylethylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 104871392 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2R)-2-(1-cyclobutylethylcarbamoylamino)butanedioic acid |
| SMILES | CC(NC(=O)N[C@H](CC(=O)O)C(=O)O)C1CCC1 |
| InChI | InChI=1S/C11H18N2O5/c1-6(7-3-2-4-7)12-11(18)13-8(10(16)17)5-9(14)15/h6-8H,2-5H2,1H3,(H,14,15)(H,16,17)(H2,12,13,18)/t6?,8-/m1/s1 |
| InChIKey | UFKJPJBYILXUON-QFSRMBNQSA-N |
| XLogP | 0.40 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |