C12H21N3O2 — CID 104871455
N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(oxolan-2-yl)propan-1-amine (PubChem CID 104871455) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 104871455 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(oxolan-2-yl)propan-1-amine |
| SMILES | Cc1noc(CCNCCCC2CCCO2)n1 |
| InChI | InChI=1S/C12H21N3O2/c1-10-14-12(17-15-10)6-8-13-7-2-4-11-5-3-9-16-11/h11,13H,2-9H2,1H3 |
| InChIKey | BYYRLWRFLMZDCZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|