About 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one
2-prop-2-enoxycyclohepta-2,4,6-trien-1-one (PubChem CID 10487198) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one |
| PubChem CID | 10487198 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one |
| SMILES | C=CCOc1cccccc1=O |
| InChI | InChI=1S/C10H10O2/c1-2-8-12-10-7-5-3-4-6-9(10)11/h2-7H,1,8H2 |
| InChIKey | HCEXRWATXSAHFS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one (CID 10487198) is 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one is C=CCOc1cccccc1=O.
What is the InChIKey of 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one?
The InChIKey is HCEXRWATXSAHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-8-12-10-7-5-3-4-6-9(10)11/h2-7H,1,8H2.
What are the key properties of 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one?
2-prop-2-enoxycyclohepta-2,4,6-trien-1-one has a molecular weight of 162.19 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoxycyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 10487198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).