C9H20N2O — CID 104873144
N-[(2R)-1-aminopropan-2-yl]-2,3-dimethylbutanamide (PubChem CID 104873144) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N-[(2R)-1-aminopropan-2-yl]-2,3-dimethylbutanamide.
| Compound Name | N-[(2R)-1-aminopropan-2-yl]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 104873144 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N-[(2R)-1-aminopropan-2-yl]-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)N[C@H](C)CN |
| InChI | InChI=1S/C9H20N2O/c1-6(2)8(4)9(12)11-7(3)5-10/h6-8H,5,10H2,1-4H3,(H,11,12)/t7-,8?/m1/s1 |
| InChIKey | KFSWEHDNQWLJDM-GVHYBUMESA-N |
| XLogP | 0.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |