C11H19NO4 — CID 104873644
4-[(3-hydroxy-2-methylbutan-2-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 104873644) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methylbutan-2-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(3-hydroxy-2-methylbutan-2-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 104873644 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4-[(3-hydroxy-2-methylbutan-2-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(C)(C)C(C)O |
| InChI | InChI=1S/C11H19NO4/c1-6(7(2)10(15)16)9(14)12-11(4,5)8(3)13/h8,13H,1-5H3,(H,12,14)(H,15,16) |
| InChIKey | QSGCUWJTMBVOFG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|