About N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide
N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide (PubChem CID 104873844) has the molecular formula C8H19N3O3S
and a molecular weight of 237.32 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide |
| PubChem CID | 104873844 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide |
| SMILES | CC(C)S(=O)(=O)NCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C8H19N3O3S/c1-6(2)15(13,14)10-5-8(3,4)7(9)11-12/h6,10,12H,5H2,1-4H3,(H2,9,11) |
| InChIKey | JNKRMHTVUBEAMY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide?
The IUPAC name of N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide (CID 104873844) is N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide.
What is the SMILES notation for N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide?
The canonical SMILES for N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide is CC(C)S(=O)(=O)NCC(C)(C)C(N)=NO.
What is the InChIKey of N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide?
The InChIKey is JNKRMHTVUBEAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3O3S/c1-6(2)15(13,14)10-5-8(3,4)7(9)11-12/h6,10,12H,5H2,1-4H3,(H2,9,11).
What are the key properties of N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide?
N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide has a molecular weight of 237.32 g/mol, XLogP of 0.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-2,2-dimethyl-3-(propan-2-ylsulfonylamino)propanimidamide is sourced from PubChem (CID 104873844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).