C9H18F3N3O3S — CID 104873852
N'-hydroxy-2,2-dimethyl-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide (PubChem CID 104873852) has the molecular formula C9H18F3N3O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide |
|---|---|
| PubChem CID | 104873852 |
| Molecular Formula | C9H18F3N3O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide |
| SMILES | CC(C)(CNS(=O)(=O)CCCC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C9H18F3N3O3S/c1-8(2,7(13)15-16)6-14-19(17,18)5-3-4-9(10,11)12/h14,16H,3-6H2,1-2H3,(H2,13,15) |
| InChIKey | ZDIXKQXEXCVJJN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|