C7H17N3O3S — CID 104873853
3-(ethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide (PubChem CID 104873853) has the molecular formula C7H17N3O3S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(ethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide.
| Compound Name | 3-(ethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 104873853 |
| Molecular Formula | C7H17N3O3S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(ethylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
| SMILES | CCS(=O)(=O)NCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C7H17N3O3S/c1-4-14(12,13)9-5-7(2,3)6(8)10-11/h9,11H,4-5H2,1-3H3,(H2,8,10) |
| InChIKey | JTKUJAYBDUKZQH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|