C7H18N4O3S — CID 104873865
3-(dimethylsulfamoylamino)-N'-hydroxy-2,2-dimethylpropanimidamide (PubChem CID 104873865) has the molecular formula C7H18N4O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-N'-hydroxy-2,2-dimethylpropanimidamide.
| Compound Name | 3-(dimethylsulfamoylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 104873865 |
| Molecular Formula | C7H18N4O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
| SMILES | CN(C)S(=O)(=O)NCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C7H18N4O3S/c1-7(2,6(8)10-12)5-9-15(13,14)11(3)4/h9,12H,5H2,1-4H3,(H2,8,10) |
| InChIKey | DGLQCJYYTNSMLB-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|