C10H12N2O6 — CID 104874115
(2S)-2-(furan-3-ylmethylcarbamoylamino)butanedioic acid (PubChem CID 104874115) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is (2S)-2-(furan-3-ylmethylcarbamoylamino)butanedioic acid.
| Compound Name | (2S)-2-(furan-3-ylmethylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 104874115 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2S)-2-(furan-3-ylmethylcarbamoylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)NCc1ccoc1)C(=O)O |
| InChI | InChI=1S/C10H12N2O6/c13-8(14)3-7(9(15)16)12-10(17)11-4-6-1-2-18-5-6/h1-2,5,7H,3-4H2,(H,13,14)(H,15,16)(H2,11,12,17)/t7-/m0/s1 |
| InChIKey | HUMKGPBSGJOWGA-ZETCQYMHSA-N |
| XLogP | 0.01 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |