C9H11N3O4 — CID 104874131
2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 104874131) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 104874131 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)Nc1nc(C)no1 |
| InChI | InChI=1S/C9H11N3O4/c1-4(5(2)8(14)15)7(13)11-9-10-6(3)12-16-9/h1-3H3,(H,14,15)(H,10,11,12,13) |
| InChIKey | DYLARJMUDJNAOM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|