C10H12N4O5 — CID 104874180
2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 104874180) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 104874180 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2,3-dimethyl-4-[(3-methyl-1,2,4-oxadiazol-5-yl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)Nc1nc(C)no1 |
| InChI | InChI=1S/C10H12N4O5/c1-4(5(2)8(16)17)7(15)12-9(18)13-10-11-6(3)14-19-10/h1-3H3,(H,16,17)(H2,11,12,13,14,15,18) |
| InChIKey | SJUJMPAUYLWVMH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|