About 2-ethyl-7,8-dimethylpurine
2-ethyl-7,8-dimethylpurine (PubChem CID 10487505) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-ethyl-7,8-dimethylpurine.
Molecular Properties
| Compound Name | 2-ethyl-7,8-dimethylpurine |
| PubChem CID | 10487505 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-ethyl-7,8-dimethylpurine |
| SMILES | CCc1ncc2c(n1)nc(C)n2C |
| InChI | InChI=1S/C9H12N4/c1-4-8-10-5-7-9(12-8)11-6(2)13(7)3/h5H,4H2,1-3H3 |
| InChIKey | NZYJNWKMKNBDHG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-7,8-dimethylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7,8-dimethylpurine?
The IUPAC name of 2-ethyl-7,8-dimethylpurine (CID 10487505) is 2-ethyl-7,8-dimethylpurine.
What is the SMILES notation for 2-ethyl-7,8-dimethylpurine?
The canonical SMILES for 2-ethyl-7,8-dimethylpurine is CCc1ncc2c(n1)nc(C)n2C.
What is the InChIKey of 2-ethyl-7,8-dimethylpurine?
The InChIKey is NZYJNWKMKNBDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-4-8-10-5-7-9(12-8)11-6(2)13(7)3/h5H,4H2,1-3H3.
What are the key properties of 2-ethyl-7,8-dimethylpurine?
2-ethyl-7,8-dimethylpurine has a molecular weight of 176.22 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7,8-dimethylpurine is sourced from PubChem (CID 10487505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).