About 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine
5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 10487531) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| PubChem CID | 10487531 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCc1c[nH]c2nc(N)nc(N)c12 |
| InChI | InChI=1S/C8H11N5/c1-2-4-3-11-7-5(4)6(9)12-8(10)13-7/h3H,2H2,1H3,(H5,9,10,11,12,13) |
| InChIKey | JRNBKJIRZOVGBO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine?
The IUPAC name of 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (CID 10487531) is 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine?
The canonical SMILES for 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine is CCc1c[nH]c2nc(N)nc(N)c12.
What is the InChIKey of 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine?
The InChIKey is JRNBKJIRZOVGBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-2-4-3-11-7-5(4)6(9)12-8(10)13-7/h3H,2H2,1H3,(H5,9,10,11,12,13).
What are the key properties of 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine?
5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine has a molecular weight of 177.21 g/mol, XLogP of 0.68, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine is sourced from PubChem (CID 10487531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).