About 1-butyl-3-ethyl-2,4-dimethylpyrrole
1-butyl-3-ethyl-2,4-dimethylpyrrole (PubChem CID 10487594) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2,4-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-butyl-3-ethyl-2,4-dimethylpyrrole |
| PubChem CID | 10487594 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-butyl-3-ethyl-2,4-dimethylpyrrole |
| SMILES | CCCCn1cc(C)c(CC)c1C |
| InChI | InChI=1S/C12H21N/c1-5-7-8-13-9-10(3)12(6-2)11(13)4/h9H,5-8H2,1-4H3 |
| InChIKey | IZEPVPMOSCBCRI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-3-ethyl-2,4-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-ethyl-2,4-dimethylpyrrole?
The IUPAC name of 1-butyl-3-ethyl-2,4-dimethylpyrrole (CID 10487594) is 1-butyl-3-ethyl-2,4-dimethylpyrrole.
What is the SMILES notation for 1-butyl-3-ethyl-2,4-dimethylpyrrole?
The canonical SMILES for 1-butyl-3-ethyl-2,4-dimethylpyrrole is CCCCn1cc(C)c(CC)c1C.
What is the InChIKey of 1-butyl-3-ethyl-2,4-dimethylpyrrole?
The InChIKey is IZEPVPMOSCBCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-5-7-8-13-9-10(3)12(6-2)11(13)4/h9H,5-8H2,1-4H3.
What are the key properties of 1-butyl-3-ethyl-2,4-dimethylpyrrole?
1-butyl-3-ethyl-2,4-dimethylpyrrole has a molecular weight of 179.31 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-ethyl-2,4-dimethylpyrrole is sourced from PubChem (CID 10487594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).