About (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one
(1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one (PubChem CID 10487672) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one.
Molecular Properties
| Compound Name | (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one |
| PubChem CID | 10487672 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one |
| SMILES | O=C1OCCCO[C@@H]2C=CC[C@H]1C2 |
| InChI | InChI=1S/C10H14O3/c11-10-8-3-1-4-9(7-8)12-5-2-6-13-10/h1,4,8-9H,2-3,5-7H2/t8-,9+/m0/s1 |
| InChIKey | KBAKYIZPRJMVFS-DTWKUNHWSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one?
The IUPAC name of (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one (CID 10487672) is (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one.
What is the SMILES notation for (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one?
The canonical SMILES for (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one is O=C1OCCCO[C@@H]2C=CC[C@H]1C2.
What is the InChIKey of (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one?
The InChIKey is KBAKYIZPRJMVFS-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H14O3/c11-10-8-3-1-4-9(7-8)12-5-2-6-13-10/h1,4,8-9H,2-3,5-7H2/t8-,9+/m0/s1.
What are the key properties of (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one?
(1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one has a molecular weight of 182.22 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8S)-2,6-dioxabicyclo[6.3.1]dodec-10-en-7-one is sourced from PubChem (CID 10487672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).