C12H23N3O3 — CID 104876980
2-(N'-hydroxycarbamimidoyl)-3-methyl-N-[1-(oxolan-3-yl)ethyl]butanamide (PubChem CID 104876980) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-3-methyl-N-[1-(oxolan-3-yl)ethyl]butanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-3-methyl-N-[1-(oxolan-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 104876980 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-3-methyl-N-[1-(oxolan-3-yl)ethyl]butanamide |
| SMILES | CC(C)C(C(=O)NC(C)C1CCOC1)C(N)=NO |
| InChI | InChI=1S/C12H23N3O3/c1-7(2)10(11(13)15-17)12(16)14-8(3)9-4-5-18-6-9/h7-10,17H,4-6H2,1-3H3,(H2,13,15)(H,14,16) |
| InChIKey | YRCDSPURVVHSIZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|