About (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one
(4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one (PubChem CID 10487713) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one.
Molecular Properties
| Compound Name | (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one |
| PubChem CID | 10487713 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one |
| SMILES | CNCCCC1=N[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C9H17N3O/c1-7-9(13)12(3)8(11-7)5-4-6-10-2/h7,10H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | JFWKUHJPPJDDRK-SSDOTTSWSA-N |
| XLogP | 0.25 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one?
The IUPAC name of (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one (CID 10487713) is (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one.
What is the SMILES notation for (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one?
The canonical SMILES for (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one is CNCCCC1=N[C@H](C)C(=O)N1C.
What is the InChIKey of (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one?
The InChIKey is JFWKUHJPPJDDRK-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H17N3O/c1-7-9(13)12(3)8(11-7)5-4-6-10-2/h7,10H,4-6H2,1-3H3/t7-/m1/s1.
What are the key properties of (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one?
(4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one has a molecular weight of 183.25 g/mol, XLogP of 0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,4-dimethyl-2-[3-(methylamino)propyl]-4H-imidazol-5-one is sourced from PubChem (CID 10487713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).