C8H10ClF3N2OS — CID 104878523
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 104878523) has the molecular formula C8H10ClF3N2OS and a molecular weight of 274.69 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 104878523 |
| Molecular Formula | C8H10ClF3N2OS |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNCc1ncc(Cl)s1 |
| InChI | InChI=1S/C8H10ClF3N2OS/c9-6-3-14-7(16-6)4-13-1-2-15-5-8(10,11)12/h3,13H,1-2,4-5H2 |
| InChIKey | IGVFCHKIVCQWBO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|