C11H7ClF2N2O2S — CID 104878764
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine (PubChem CID 104878764) has the molecular formula C11H7ClF2N2O2S and a molecular weight of 304.71 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 104878764 |
| Molecular Formula | C11H7ClF2N2O2S |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-amine |
| SMILES | FC1(F)Oc2ccc(NCc3ncc(Cl)s3)cc2O1 |
| InChI | InChI=1S/C11H7ClF2N2O2S/c12-9-4-16-10(19-9)5-15-6-1-2-7-8(3-6)18-11(13,14)17-7/h1-4,15H,5H2 |
| InChIKey | GYBBVAWXFHGWQN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|