C11H15N3 — CID 10487891
2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline (PubChem CID 10487891) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline.
| Compound Name | 2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 10487891 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline |
| SMILES | c1ccc2c(c1)NCC1CNCCN21 |
| InChI | InChI=1S/C11H15N3/c1-2-4-11-10(3-1)13-8-9-7-12-5-6-14(9)11/h1-4,9,12-13H,5-8H2 |
| InChIKey | PVOSECZBLPUJLZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |