About 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene
3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene (PubChem CID 10487897) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene.
Molecular Properties
| Compound Name | 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene |
| PubChem CID | 10487897 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene |
| SMILES | C=C1C2=CC=CC1CN(C)CCCC2 |
| InChI | InChI=1S/C13H19N/c1-11-12-6-3-4-9-14(2)10-13(11)8-5-7-12/h5,7-8,13H,1,3-4,6,9-10H2,2H3 |
| InChIKey | BKCIFYJUXCUDJX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene?
The IUPAC name of 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene (CID 10487897) is 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene.
What is the SMILES notation for 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene?
The canonical SMILES for 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene is C=C1C2=CC=CC1CN(C)CCCC2.
What is the InChIKey of 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene?
The InChIKey is BKCIFYJUXCUDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-11-12-6-3-4-9-14(2)10-13(11)8-5-7-12/h5,7-8,13H,1,3-4,6,9-10H2,2H3.
What are the key properties of 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene?
3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene has a molecular weight of 189.30 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-12-methylidene-3-azabicyclo[6.3.1]dodeca-8,10-diene is sourced from PubChem (CID 10487897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).