C9H12ClF3N2S — CID 104879498
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 104879498) has the molecular formula C9H12ClF3N2S and a molecular weight of 272.72 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 104879498 |
| Molecular Formula | C9H12ClF3N2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | FC(F)(F)CCCCNCc1ncc(Cl)s1 |
| InChI | InChI=1S/C9H12ClF3N2S/c10-7-5-15-8(16-7)6-14-4-2-1-3-9(11,12)13/h5,14H,1-4,6H2 |
| InChIKey | VWWVZYOSLXYPJB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|