C14H23NO2S — CID 104879739
ethyl 3-(2-prop-2-ynylsulfanylethylamino)cyclohexane-1-carboxylate (PubChem CID 104879739) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is ethyl 3-(2-prop-2-ynylsulfanylethylamino)cyclohexane-1-carboxylate.
| Compound Name | ethyl 3-(2-prop-2-ynylsulfanylethylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 104879739 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl 3-(2-prop-2-ynylsulfanylethylamino)cyclohexane-1-carboxylate |
| SMILES | C#CCSCCNC1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C14H23NO2S/c1-3-9-18-10-8-15-13-7-5-6-12(11-13)14(16)17-4-2/h1,12-13,15H,4-11H2,2H3 |
| InChIKey | OIDMZAYRZUPSAB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|