C14H11BrN2OS — CID 104880459
N-(5-bromo-2-cyanophenyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 104880459) has the molecular formula C14H11BrN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is N-(5-bromo-2-cyanophenyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(5-bromo-2-cyanophenyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 104880459 |
| Molecular Formula | C14H11BrN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N-(5-bromo-2-cyanophenyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(Br)ccc2C#N)sc1C |
| InChI | InChI=1S/C14H11BrN2OS/c1-8-5-13(19-9(8)2)14(18)17-12-6-11(15)4-3-10(12)7-16/h3-6H,1-2H3,(H,17,18) |
| InChIKey | JQYOGRVIFYNKCY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |