About 3-(2-methylphenyl)-1,4-oxathiane
3-(2-methylphenyl)-1,4-oxathiane (PubChem CID 10488071) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-(2-methylphenyl)-1,4-oxathiane.
Molecular Properties
| Compound Name | 3-(2-methylphenyl)-1,4-oxathiane |
| PubChem CID | 10488071 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-(2-methylphenyl)-1,4-oxathiane |
| SMILES | Cc1ccccc1C1COCCS1 |
| InChI | InChI=1S/C11H14OS/c1-9-4-2-3-5-10(9)11-8-12-6-7-13-11/h2-5,11H,6-8H2,1H3 |
| InChIKey | QSGXARUWKBNWHZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-methylphenyl)-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylphenyl)-1,4-oxathiane?
The IUPAC name of 3-(2-methylphenyl)-1,4-oxathiane (CID 10488071) is 3-(2-methylphenyl)-1,4-oxathiane.
What is the SMILES notation for 3-(2-methylphenyl)-1,4-oxathiane?
The canonical SMILES for 3-(2-methylphenyl)-1,4-oxathiane is Cc1ccccc1C1COCCS1.
What is the InChIKey of 3-(2-methylphenyl)-1,4-oxathiane?
The InChIKey is QSGXARUWKBNWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-9-4-2-3-5-10(9)11-8-12-6-7-13-11/h2-5,11H,6-8H2,1H3.
What are the key properties of 3-(2-methylphenyl)-1,4-oxathiane?
3-(2-methylphenyl)-1,4-oxathiane has a molecular weight of 194.30 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylphenyl)-1,4-oxathiane is sourced from PubChem (CID 10488071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).