C16H23NO2 — CID 104881612
3-[[(1R)-1-(2-methylphenyl)ethyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 104881612) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[[(1R)-1-(2-methylphenyl)ethyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[(1R)-1-(2-methylphenyl)ethyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104881612 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-[[(1R)-1-(2-methylphenyl)ethyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccccc1[C@@H](C)NC1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C16H23NO2/c1-11-6-3-4-9-15(11)12(2)17-14-8-5-7-13(10-14)16(18)19/h3-4,6,9,12-14,17H,5,7-8,10H2,1-2H3,(H,18,19)/t12-,13?,14?/m1/s1 |
| InChIKey | DCUUAMWKWQHFNB-IYXRBSQSSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |