About 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine
3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine (PubChem CID 104881908) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine |
| PubChem CID | 104881908 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\NN)N(C)CC1CCC1 |
| InChI | InChI=1S/C8H18N4/c1-10-8(11-9)12(2)6-7-4-3-5-7/h7H,3-6,9H2,1-2H3,(H,10,11) |
| InChIKey | WGSHMTYPQMIPSV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine?
The IUPAC name of 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine (CID 104881908) is 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine.
What is the SMILES notation for 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine?
The canonical SMILES for 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine is C/N=C(\NN)N(C)CC1CCC1.
What is the InChIKey of 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine?
The InChIKey is WGSHMTYPQMIPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-10-8(11-9)12(2)6-7-4-3-5-7/h7H,3-6,9H2,1-2H3,(H,10,11).
What are the key properties of 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine?
3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine has a molecular weight of 170.26 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(cyclobutylmethyl)-1,2-dimethylguanidine is sourced from PubChem (CID 104881908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).