C8H18N4O — CID 104881957
N-amino-N',2,6-trimethylmorpholine-4-carboximidamide (PubChem CID 104881957) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is N-amino-N',2,6-trimethylmorpholine-4-carboximidamide.
| Compound Name | N-amino-N',2,6-trimethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 104881957 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | N-amino-N',2,6-trimethylmorpholine-4-carboximidamide |
| SMILES | C/N=C(\NN)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C8H18N4O/c1-6-4-12(5-7(2)13-6)8(10-3)11-9/h6-7H,4-5,9H2,1-3H3,(H,10,11) |
| InChIKey | XGEFKIVEUVBENR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|