About 3-amino-1,2-dimethyl-1-propylguanidine
3-amino-1,2-dimethyl-1-propylguanidine (PubChem CID 104881974) has the molecular formula C6H16N4
and a molecular weight of 144.22 g/mol. Its IUPAC name is 3-amino-1,2-dimethyl-1-propylguanidine.
Molecular Properties
| Compound Name | 3-amino-1,2-dimethyl-1-propylguanidine |
| PubChem CID | 104881974 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 3-amino-1,2-dimethyl-1-propylguanidine |
| SMILES | CCCN(C)/C(=N\C)NN |
| InChI | InChI=1S/C6H16N4/c1-4-5-10(3)6(8-2)9-7/h4-5,7H2,1-3H3,(H,8,9) |
| InChIKey | UDSHQBXEKJAURZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,2-dimethyl-1-propylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,2-dimethyl-1-propylguanidine?
The IUPAC name of 3-amino-1,2-dimethyl-1-propylguanidine (CID 104881974) is 3-amino-1,2-dimethyl-1-propylguanidine.
What is the SMILES notation for 3-amino-1,2-dimethyl-1-propylguanidine?
The canonical SMILES for 3-amino-1,2-dimethyl-1-propylguanidine is CCCN(C)/C(=N\C)NN.
What is the InChIKey of 3-amino-1,2-dimethyl-1-propylguanidine?
The InChIKey is UDSHQBXEKJAURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N4/c1-4-5-10(3)6(8-2)9-7/h4-5,7H2,1-3H3,(H,8,9).
What are the key properties of 3-amino-1,2-dimethyl-1-propylguanidine?
3-amino-1,2-dimethyl-1-propylguanidine has a molecular weight of 144.22 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,2-dimethyl-1-propylguanidine is sourced from PubChem (CID 104881974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).