C7H16N4S — CID 104881985
3-amino-1,2-dimethyl-1-(thiolan-3-yl)guanidine (PubChem CID 104881985) has the molecular formula C7H16N4S and a molecular weight of 188.30 g/mol. Its IUPAC name is 3-amino-1,2-dimethyl-1-(thiolan-3-yl)guanidine.
| Compound Name | 3-amino-1,2-dimethyl-1-(thiolan-3-yl)guanidine |
|---|---|
| PubChem CID | 104881985 |
| Molecular Formula | C7H16N4S |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 3-amino-1,2-dimethyl-1-(thiolan-3-yl)guanidine |
| SMILES | C/N=C(\NN)N(C)C1CCSC1 |
| InChI | InChI=1S/C7H16N4S/c1-9-7(10-8)11(2)6-3-4-12-5-6/h6H,3-5,8H2,1-2H3,(H,9,10) |
| InChIKey | ZDXNPBPITNWQKG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|