C8H20N4 — CID 104881993
1-amino-2-methyl-3-(4-methylpentan-2-yl)guanidine (PubChem CID 104881993) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is 1-amino-2-methyl-3-(4-methylpentan-2-yl)guanidine.
| Compound Name | 1-amino-2-methyl-3-(4-methylpentan-2-yl)guanidine |
|---|---|
| PubChem CID | 104881993 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | 1-amino-2-methyl-3-(4-methylpentan-2-yl)guanidine |
| SMILES | C/N=C(\NN)NC(C)CC(C)C |
| InChI | InChI=1S/C8H20N4/c1-6(2)5-7(3)11-8(10-4)12-9/h6-7H,5,9H2,1-4H3,(H2,10,11,12) |
| InChIKey | QPBMEBXQHYTTPE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|